Notice: This page requires JavaScript to function properly.
Please enable JavaScript in your browser settings or update your browser.
Aprende Molecular Descriptors and Fingerprints | Molecular Representations and Parsing
Python for Chemoinformatics

Molecular Descriptors and Fingerprints

Desliza para mostrar el menú

Molecular descriptors and fingerprints are two foundational concepts in chemoinformatics that allow you to numerically represent chemical structures for computational analysis. Molecular descriptors are quantitative values derived from chemical structures, such as molecular weight, number of hydrogen bond donors, or calculated logP (a measure of hydrophobicity). Fingerprints, on the other hand, are typically binary or count-based vectors that encode the presence or absence of specific substructures or patterns in a molecule. These representations make it possible to compare, cluster, and analyze molecules efficiently in silico, supporting tasks like virtual screening, similarity search, and machine learning applications in chemistry.

Note
Definition

A molecular descriptor is a numerical value that quantifies a specific property or characteristic of a molecule, such as its weight or hydrophobicity.
A molecular fingerprint is a vector (often binary) that represents the presence or absence of certain structural features or patterns within a molecule.

123456789101112131415
# Compute simple molecular descriptors using RDKit from rdkit import Chem from rdkit.Chem import Descriptors # Example molecule: caffeine (SMILES string) smiles = "Cn1cnc2c1c(=O)n(C)c(=O)n2C" mol = Chem.MolFromSmiles(smiles) # Calculate molecular weight mol_weight = Descriptors.MolWt(mol) print("Molecular Weight:", mol_weight) # Calculate logP (octanol-water partition coefficient) logp = Descriptors.MolLogP(mol) print("LogP:", logp)

Descriptors and fingerprints serve distinct but complementary roles in chemoinformatics. Descriptors, such as molecular weight or logP, are numerical values that summarize specific physicochemical properties of a molecule. For example, the molecular weight tells you the sum of atomic masses, while logP estimates how soluble a molecule is in fat versus water. Fingerprints, in contrast, are usually long bit vectors or arrays that encode the presence of chemical features or substructures. For instance, a fingerprint might indicate whether a molecule contains an aromatic ring or a carboxylic acid group. While descriptors provide insight into individual properties, fingerprints enable rapid comparison of molecular structures for tasks like similarity searching.

Note
Note

Morgan Fingerprint Basics:

  • A Morgan fingerprint encodes local neighborhoods of each atom;
  • You pick a "radius" (e.g., 2), which means you include atoms up to two bonds away from each central atom when constructing each substructure;
  • Each unique substructure is hashed into one of a fixed number of bit positions (here, 2,048).
123456789
# Generate a Morgan fingerprint (circular fingerprint) with RDKit from rdkit.Chem import AllChem # Morgan fingerprint (radius 2, 2048 bits) fp = AllChem.GetMorganFingerprintAsBitVect(mol, radius=2, nBits=2048) # Convert fingerprint to a list of bits (for illustration) fp_bits = list(fp) print("First 32 bits of Morgan fingerprint:", fp_bits[:32])
  • mol is an RDKit Mol object representing your molecule;
  • radius=2 sets the neighborhood size;
  • nBits=2048 fixes the fingerprint length to 2,048 bits;
  • The result, fp, is an instance of ExplicitBitVect.

Bit‐Vector Representation

Each bit in this 2,048‐bit vector corresponds to whether a particular hashed substructure was seen (1) or not (0). Because hashing can collide, different substructures may sometimes map to the same bit.

fp_bits = list(fp)

This simply turns the bit­vector into a list of 0s and 1s so you can inspect or manipulate it as a regular Python list.

In chemoinformatics, both descriptors and fingerprints are essential for analyzing and comparing molecules at scale.

1. What is a molecular fingerprint?

2. Which RDKit function computes molecular weight?

3. Why are fingerprints important in chemoinformatics?

question mark

What is a molecular fingerprint?

Selecciona la respuesta correcta

question mark

Which RDKit function computes molecular weight?

Selecciona la respuesta correcta

question mark

Why are fingerprints important in chemoinformatics?

Selecciona todas las respuestas correctas

¿Todo estuvo claro?

¿Cómo podemos mejorarlo?

¡Gracias por tus comentarios!

Sección 1. Capítulo 5

Pregunte a AI

expand

Pregunte a AI

ChatGPT

Pregunte lo que quiera o pruebe una de las preguntas sugeridas para comenzar nuestra charla

Sección 1. Capítulo 5
some-alt